Information card for entry 2228299
| Chemical name |
2-(4-Methoxybenzylidene)-4,4-dimethyl-3,4-dihydronaphthalen-1(2<i>H</i>)-one |
| Formula |
C20 H20 O2 |
| Calculated formula |
C20 H20 O2 |
| SMILES |
C1(=O)c2c(C(C/C1=C\c1ccc(cc1)OC)(C)C)cccc2 |
| Title of publication |
2-(4-Methoxybenzylidene)-4,4-dimethyl-3,4-dihydronaphthalen-1(2<i>H</i>)-one |
| Authors of publication |
Akhazzane, Mohamed; Zouihri, Hafid; Daran, Jean-Claude; Kerbal, Abdelali; Al Houari, Ghali |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3067 |
| a |
11.8587 ± 0.0003 Å |
| b |
8.7536 ± 0.0002 Å |
| c |
14.9392 ± 0.0004 Å |
| α |
90° |
| β |
96.527 ± 0.001° |
| γ |
90° |
| Cell volume |
1540.73 ± 0.07 Å3 |
| Cell temperature |
190 ± 2 K |
| Ambient diffraction temperature |
190 ± 2 K |
| Cell measurement pressure |
101 kPa |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.046 |
| Residual factor for significantly intense reflections |
0.039 |
| Weighted residual factors for significantly intense reflections |
0.1038 |
| Weighted residual factors for all reflections included in the refinement |
0.108 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.083 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228299.html