Information card for entry 2228429
| Chemical name |
[1,1-(Butane-1,4-diyl)-2,3-dicyclohexylguanidinato]dimethylaluminum(III) |
| Formula |
C19 H36 Al N3 |
| Calculated formula |
C19 H36 Al N3 |
| SMILES |
[Al]1([N](C2CCCCC2)=C(N1C1CCCCC1)N1CCCC1)(C)C |
| Title of publication |
[1,1-(Butane-1,4-diyl)-2,3-dicyclohexylguanidinato]dimethylaluminum(III) |
| Authors of publication |
Li, Haoyang; Xiang, Yonggang; Han, Hongfei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
m1598 |
| a |
18.263 ± 0.004 Å |
| b |
10.596 ± 0.002 Å |
| c |
10.449 ± 0.002 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2022 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
60 |
| Hermann-Mauguin space group symbol |
P b c n |
| Hall space group symbol |
-P 2n 2ab |
| Residual factor for all reflections |
0.099 |
| Residual factor for significantly intense reflections |
0.0951 |
| Weighted residual factors for significantly intense reflections |
0.2304 |
| Weighted residual factors for all reflections included in the refinement |
0.2319 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.417 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228429.html