Information card for entry 2228431
| Chemical name |
4-[3-(1<i>H</i>-Imidazol-1-yl)propyl]-3-methyl-5-(thiophen-2-ylmethyl)- 4<i>H</i>-1,2,4-triazole monohydrate |
| Formula |
C14 H19 N5 O S |
| Calculated formula |
C14 H19 N5 O S |
| SMILES |
s1c(Cc2n(c(nn2)C)CCCn2ccnc2)ccc1.O |
| Title of publication |
4-[3-(1<i>H</i>-Imidazol-1-yl)propyl]-3-methyl-5-(thiophen-2-ylmethyl)-4<i>H</i>-1,2,4-triazole monohydrate |
| Authors of publication |
Gurumoorthy, Anuradha; Gopalsamy, Vasuki; Ünlüer, Dilek; Kör, Gülcan; Ramamurthi, K. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2010 |
| Journal volume |
66 |
| Journal issue |
12 |
| Pages of publication |
o3150 - o3151 |
| a |
9.5584 ± 0.0012 Å |
| b |
9.4873 ± 0.001 Å |
| c |
17.644 ± 0.003 Å |
| α |
90° |
| β |
99.36 ± 0.012° |
| γ |
90° |
| Cell volume |
1578.7 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0574 |
| Residual factor for significantly intense reflections |
0.051 |
| Weighted residual factors for significantly intense reflections |
0.1309 |
| Weighted residual factors for all reflections included in the refinement |
0.1367 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.121 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228431.html