Information card for entry 2228804
| Chemical name |
2-acetyl-3,5,5,9-tetramethyl-6,7,8,9-tetrahydro-5<i>H</i>-benzocyclohepten-7-one |
| Formula |
C17 H22 O2 |
| Calculated formula |
C17 H22 O2 |
| SMILES |
c12c(cc(c(c1)C)C(=O)C)C(CC(=O)CC2(C)C)C |
| Title of publication |
2-Acetyl-3,5,5,9-tetramethyl-6,7,8,9-tetrahydro-5<i>H</i>-benzocyclohepten-7-one |
| Authors of publication |
Benharref, Ahmed; Mazoir, Noureddine; Lassaba, Essediya; Daran, Jean-Claude; Berraho, Moha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o58 |
| a |
7.7996 ± 0.0006 Å |
| b |
18.3702 ± 0.001 Å |
| c |
9.9357 ± 0.0006 Å |
| α |
90° |
| β |
99.616 ± 0.007° |
| γ |
90° |
| Cell volume |
1403.59 ± 0.16 Å3 |
| Cell temperature |
180 ± 2 K |
| Ambient diffraction temperature |
180 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0674 |
| Residual factor for significantly intense reflections |
0.0519 |
| Weighted residual factors for significantly intense reflections |
0.1396 |
| Weighted residual factors for all reflections included in the refinement |
0.1452 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.077 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228804.html