Information card for entry 2228922
| Chemical name |
<i>rac</i>-(1<i>R</i>*,2<i>S</i>*,3<i>S</i>*)-Diethyl 4-methyl-2-phenyl-6-(2-phenylhydrazinylidene)cyclohex-4-ene-1,3-dicarboxylate |
| Formula |
C25 H28 N2 O4 |
| Calculated formula |
C25 H28 N2 O4 |
| SMILES |
O(C(=O)[C@H]1[C@@H]([C@H](C(=CC1=NNc1ccccc1)C)C(=O)OCC)c1ccccc1)CC.O(C(=O)[C@@H]1[C@H]([C@@H](C(=CC1=NNc1ccccc1)C)C(=O)OCC)c1ccccc1)CC |
| Title of publication |
<i>rac</i>-(1<i>R</i>*,2<i>S</i>*,3<i>S</i>*)-Diethyl 4-methyl-2-phenyl-6-(2-phenylhydrazinylidene)cyclohex-4-ene-1,3-dicarboxylate |
| Authors of publication |
Maharramov, Abel M.; Ismiyev, Arif I.; Rashidov, Bahruz A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
1 |
| Pages of publication |
o153 |
| a |
11.5271 ± 0.001 Å |
| b |
13.4599 ± 0.0012 Å |
| c |
14.4479 ± 0.0013 Å |
| α |
90° |
| β |
93.342 ± 0.002° |
| γ |
90° |
| Cell volume |
2237.8 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0736 |
| Residual factor for significantly intense reflections |
0.0511 |
| Weighted residual factors for significantly intense reflections |
0.1285 |
| Weighted residual factors for all reflections included in the refinement |
0.1485 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.999 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2228922.html