Information card for entry 2229073
| Common name |
(-)-Crebanine |
| Chemical name |
9,10-dimethoxy-7-methyl-6,7,7a,8-tetrahydro-5<i>H</i>- benzo[<i>g</i>][1,3]benzodioxolo[6,5,4-<i>de</i>]quinoline |
| Formula |
C20 H21 N O4 |
| Calculated formula |
C20 H21 N O4 |
| SMILES |
COc1c(OC)ccc2c1C[C@H]1N(C)CCc3c1c2c1OCOc1c3 |
| Title of publication |
({-})-Crebanine |
| Authors of publication |
Duangthongyou, Tanwawan; Makarasen, Arthit; Techasakul, Supanna; Chimnoi, Nitirat; Siripaisarnpipat, Sutatip |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o402 |
| a |
4.4029 ± 0.0003 Å |
| b |
20.5847 ± 0.0015 Å |
| c |
39.612 ± 0.003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3590.1 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for significantly intense reflections |
0.105 |
| Weighted residual factors for all reflections included in the refinement |
0.2493 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.2 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229073.html