Information card for entry 2229110
| Chemical name |
Benzyl <i>N</i>-{2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-yl}carbamate |
| Formula |
C19 H18 Cl N3 O3 |
| Calculated formula |
C19 H18 Cl N3 O3 |
| SMILES |
Clc1ccc(cc1)c1onc(n1)C(NC(=O)OCc1ccccc1)(C)C |
| Title of publication |
Benzyl <i>N</i>-{2-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]propan-2-yl}carbamate |
| Authors of publication |
Fun, Hoong-Kun; Sumangala, V.; Nagaraja, G. K.; Poojary, Boja; Chantrapromma, Suchada |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o420 - o421 |
| a |
7.7501 ± 0.0001 Å |
| b |
11.0052 ± 0.0002 Å |
| c |
20.9834 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1789.7 ± 0.05 Å3 |
| Cell temperature |
297 K |
| Ambient diffraction temperature |
297 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0517 |
| Residual factor for significantly intense reflections |
0.0361 |
| Weighted residual factors for significantly intense reflections |
0.0794 |
| Weighted residual factors for all reflections included in the refinement |
0.0865 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.024 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229110.html