Information card for entry 2229245
| Chemical name |
3,5-Bis(4-methoxyphenyl)-1-phenyl-4,5-dihydro-1<i>H</i>-pyrazole |
| Formula |
C23 H22 N2 O2 |
| Calculated formula |
C23 H22 N2 O2 |
| SMILES |
O(c1ccc(cc1)C1=NN(C(C1)c1ccc(OC)cc1)c1ccccc1)C |
| Title of publication |
3,5-Bis(4-methoxyphenyl)-1-phenyl-4,5-dihydro-1<i>H</i>-pyrazole |
| Authors of publication |
Baktır, Zeliha; Akkurt, Mehmet; Samshuddin, S.; Narayana, B.; Yathirajan, H. S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
2 |
| Pages of publication |
o328 - o329 |
| a |
9.4788 ± 0.0005 Å |
| b |
10.1893 ± 0.0006 Å |
| c |
19.9139 ± 0.001 Å |
| α |
90° |
| β |
92.296 ± 0.004° |
| γ |
90° |
| Cell volume |
1921.79 ± 0.18 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.1944 |
| Residual factor for significantly intense reflections |
0.062 |
| Weighted residual factors for significantly intense reflections |
0.1372 |
| Weighted residual factors for all reflections included in the refinement |
0.1839 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.898 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229245.html