Information card for entry 2229447
| Chemical name |
[2,9-Bis(3,5-dimethyl-1<i>H</i>-pyrazol-1-yl-κ<i>N</i>^2^)-1,10- phenanthroline-κ^2^<i>N</i>,<i>N</i>'](methanol-κ<i>O</i>)(nitrito- κ^2^<i>O</i>,<i>O</i>')cadmium(II) perchlorate |
| Formula |
C23 H24 Cd Cl N7 O7 |
| Calculated formula |
C23 H24 Cd Cl N7 O7 |
| SMILES |
Cc1cc(C)n2c3ccc4c5c6c(cc4)ccc4[n]6[Cd]6([n]12)([n]35)([n]1c(cc(C)n41)C)([O]=NO6)[OH]C.Cl(=O)(=O)(=O)[O-] |
| Title of publication |
[2,9-Bis(3,5-dimethyl-1<i>H</i>-pyrazol-1-yl-κ<i>N</i>^2^)-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>'](methanol-κ<i>O</i>)(nitrito-κ^2^<i>O</i>,<i>O</i>')cadmium(II) perchlorate |
| Authors of publication |
Liu, Li Zhen; Chi, Yan Hui; Du, Hua; Shi, Jing Min |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
3 |
| Pages of publication |
m330 |
| a |
8.0241 ± 0.0017 Å |
| b |
11.58 ± 0.002 Å |
| c |
15.842 ± 0.003 Å |
| α |
68.595 ± 0.002° |
| β |
75.578 ± 0.002° |
| γ |
73.616 ± 0.003° |
| Cell volume |
1297.1 ± 0.4 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0548 |
| Residual factor for significantly intense reflections |
0.0435 |
| Weighted residual factors for significantly intense reflections |
0.099 |
| Weighted residual factors for all reflections included in the refinement |
0.1113 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.023 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229447.html