Information card for entry 2229677
| Chemical name |
3,4-Dimethyl-1-phenylpyrano[2,3-<i>c</i>]pyrazol-6(1<i>H</i>)-one |
| Formula |
C14 H12 N2 O2 |
| Calculated formula |
C14 H12 N2 O2 |
| SMILES |
o1c2n(nc(c2c(cc1=O)C)C)c1ccccc1 |
| Title of publication |
3,4-Dimethyl-1-phenylpyrano[2,3-<i>c</i>]pyrazol-6(1<i>H</i>)-one |
| Authors of publication |
Ahmad, Neman; Tahir, M. Nawaz; Khan, Misbahul Ain; Ather, Abdul Qayyum; Khan, Muhammad Naeem |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o1021 |
| a |
15.1231 ± 0.0009 Å |
| b |
13.3558 ± 0.0008 Å |
| c |
13.8684 ± 0.0008 Å |
| α |
90° |
| β |
120.965 ± 0.002° |
| γ |
90° |
| Cell volume |
2401.9 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0783 |
| Residual factor for significantly intense reflections |
0.0455 |
| Weighted residual factors for significantly intense reflections |
0.1174 |
| Weighted residual factors for all reflections included in the refinement |
0.1403 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.021 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229677.html