Information card for entry 2229743
| Chemical name |
<i>rac</i>-(3<i>S</i>,4<i>S</i>)-3-Hydroxy-4-phenyl-1-[(<i>S</i>)-(3-phenyl- 4,5-dihydro-1,2-oxazol-5-yl)methyl]-4,5-dihydro-1<i>H</i>-1,5-benzodiazepin- 2(3<i>H</i>)-one |
| Formula |
C25 H23 N3 O3 |
| Calculated formula |
C25 H23 N3 O3 |
| SMILES |
O=C1[C@@H](O)[C@@H](Nc2c(N1C[C@H]1ON=C(C1)c1ccccc1)cccc2)c1ccccc1.O=C1[C@H](O)[C@H](Nc2c(N1C[C@@H]1ON=C(C1)c1ccccc1)cccc2)c1ccccc1 |
| Title of publication |
<i>rac</i>-(3<i>S</i>,4<i>S</i>)-3-Hydroxy-4-phenyl-1-[(<i>S</i>)-(3-phenyl-4,5-dihydro-1,2-oxazol-5-yl)methyl]-4,5-dihydro-1<i>H</i>-1,5-benzodiazepin-2(3<i>H</i>)-one |
| Authors of publication |
Rida, Mohamed; Essassi, El Mokhtar; Massip, Stéphane; Lazar, Saïd; Zouihri, Hafid |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o945 - o946 |
| a |
8.981 ± 0.002 Å |
| b |
9.044 ± 0.002 Å |
| c |
13.685 ± 0.001 Å |
| α |
95.373 ± 0.01° |
| β |
102.433 ± 0.01° |
| γ |
100.03 ± 0.02° |
| Cell volume |
1058.9 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0545 |
| Residual factor for significantly intense reflections |
0.0503 |
| Weighted residual factors for significantly intense reflections |
0.1527 |
| Weighted residual factors for all reflections included in the refinement |
0.1573 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229743.html