Information card for entry 2229805
| Chemical name |
1-Methyl-3-(2-methylphenyl)-3,3a,4,9b-tetrahydro-1<i>H</i>- chromeno[4,3-<i>c</i>][1,2]oxazole-3a-carbonitrile |
| Formula |
C19 H18 N2 O2 |
| Calculated formula |
C19 H18 N2 O2 |
| SMILES |
c12ccccc1[C@@H]1[C@](CO2)([C@@H](c2ccccc2C)ON1C)C#N.c12ccccc1[C@H]1[C@@](CO2)([C@H](c2ccccc2C)ON1C)C#N |
| Title of publication |
1-Methyl-3-(2-methylphenyl)-3,3a,4,9b-tetrahydro-1<i>H</i>-chromeno[4,3-<i>c</i>][1,2]oxazole-3a-carbonitrile |
| Authors of publication |
Swaminathan, K.; Sethusankar, K.; Murugan, G.; Bakthadoss, M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o905 |
| a |
11.012 ± 0.0004 Å |
| b |
13.0368 ± 0.0004 Å |
| c |
11.1977 ± 0.0003 Å |
| α |
90° |
| β |
97.836 ± 0.002° |
| γ |
90° |
| Cell volume |
1592.54 ± 0.09 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1119 |
| Residual factor for significantly intense reflections |
0.0509 |
| Weighted residual factors for significantly intense reflections |
0.1211 |
| Weighted residual factors for all reflections included in the refinement |
0.1476 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.011 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229805.html