Information card for entry 2229891
| Chemical name |
5-Chloro-<i>N</i>-(4,5-dihydro-1<i>H</i>-imidazol-2-yl)-2,1,3-benzothiadiazol- 4-amine |
| Formula |
C9 H8 Cl N5 S |
| Calculated formula |
C9 H8 Cl N5 S |
| SMILES |
Clc1ccc2c(c1NC1=NCCN1)nsn2 |
| Title of publication |
5-Chloro-<i>N</i>-(4,5-dihydro-1<i>H</i>-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine (tizanidine) |
| Authors of publication |
John, Peter; Khan, Islam Ullah; Akkurt, Mehmet; Ramzan, Muhammad Shahid; Sharif, Shahzad |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
4 |
| Pages of publication |
o838 - o839 |
| a |
7.6927 ± 0.0003 Å |
| b |
10.8558 ± 0.0004 Å |
| c |
12.9969 ± 0.0005 Å |
| α |
95.79 ± 0.001° |
| β |
101.126 ± 0.001° |
| γ |
92.192 ± 0.001° |
| Cell volume |
1057.69 ± 0.07 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0487 |
| Residual factor for significantly intense reflections |
0.0418 |
| Weighted residual factors for significantly intense reflections |
0.1128 |
| Weighted residual factors for all reflections included in the refinement |
0.1204 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229891.html