Information card for entry 2229948
| Chemical name |
<i>N</i>,<i>N</i>'-[(1<i>S</i>,2<i>S</i>)-Cyclohexane-1,2-diyl]bis(4- methylbenzenesulfonamide) |
| Formula |
C20 H26 N2 O4 S2 |
| Calculated formula |
C20 H26 N2 O4 S2 |
| SMILES |
S(=O)(=O)(c1ccc(C)cc1)N[C@@H]1[C@@H](NS(=O)(=O)c2ccc(C)cc2)CCCC1 |
| Title of publication |
<i>N</i>,<i>N</i>'-[(1<i>S</i>,2<i>S</i>)-Cyclohexane-1,2-diyl]bis(4-methylbenzenesulfonamide) |
| Authors of publication |
Hong, Yi-Ling; Tan, Hua-Jie; Shen, Liang |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o1121 |
| a |
11.5704 ± 0.0014 Å |
| b |
12.2585 ± 0.0015 Å |
| c |
15.3757 ± 0.0019 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2180.8 ± 0.5 Å3 |
| Cell temperature |
296 ± 1 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.0353 |
| Weighted residual factors for significantly intense reflections |
0.089 |
| Weighted residual factors for all reflections included in the refinement |
0.0938 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.001 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229948.html