Information card for entry 2229952
| Chemical name |
3-Methyl-6-trichloromethyl-1,2,4-triazolo[3,4-<i>b</i>][1,3,4]thiadiazole |
| Formula |
C5 H3 Cl3 N4 S |
| Calculated formula |
C5 H3 Cl3 N4 S |
| SMILES |
s1c2nnc(n2nc1C(Cl)(Cl)Cl)C |
| Title of publication |
3-Methyl-6-trichloromethyl-1,2,4-triazolo[3,4-<i>b</i>][1,3,4]thiadiazole |
| Authors of publication |
Jia, Wei-min; Wang, Zhi-jian; Jia, Xiao-yu; Zhang, Jing-jing; Wang, Wei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o1093 |
| a |
5.8732 ± 0.0012 Å |
| b |
9.4164 ± 0.0019 Å |
| c |
16.75 ± 0.003 Å |
| α |
90° |
| β |
91.82 ± 0.03° |
| γ |
90° |
| Cell volume |
925.9 ± 0.3 Å3 |
| Cell temperature |
153 ± 2 K |
| Ambient diffraction temperature |
153 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0349 |
| Residual factor for significantly intense reflections |
0.0294 |
| Weighted residual factors for significantly intense reflections |
0.0827 |
| Weighted residual factors for all reflections included in the refinement |
0.1134 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.238 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2229952.html