Information card for entry 2230073
| Chemical name |
(1<i>S</i>*,4'<i>S</i>*,5<i>R</i>*)-1-Isobutyl-5-methoxy-2',3-dimethyl-4,6- dioxa-2-azaspiro[bicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]- 1',3'(2'<i>H</i>,4'<i>H</i>)-dione |
| Formula |
C19 H22 N2 O5 |
| Calculated formula |
C19 H22 N2 O5 |
| SMILES |
O=C1N(C(=O)c2ccccc2[C@@]21O[C@@]1(OC(=N[C@]21CC(C)C)C)OC)C.O=C1N(C(=O)c2ccccc2[C@]21O[C@]1(OC(=N[C@@]21CC(C)C)C)OC)C |
| Title of publication |
(1<i>S</i>*,4'<i>S</i>*,5<i>R</i>*)-1-Isobutyl-5-methoxy-2',3-dimethyl-4,6-dioxa-2-azaspiro[bicyclo[3.2.0]hept-2-ene-7,4'-isoquinoline]-1',3'(2'<i>H</i>,4'<i>H</i>)-dione |
| Authors of publication |
Fun, Hoong-Kun; Quah, Ching Kheng; Huang, Chengmei; Yu, Haitao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o1273 - o1274 |
| a |
8.0488 ± 0.0001 Å |
| b |
13.6065 ± 0.0002 Å |
| c |
16.788 ± 0.0002 Å |
| α |
90° |
| β |
106.298 ± 0.001° |
| γ |
90° |
| Cell volume |
1764.67 ± 0.04 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0438 |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for significantly intense reflections |
0.098 |
| Weighted residual factors for all reflections included in the refinement |
0.1033 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.032 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230073.html