Information card for entry 2230087
| Chemical name |
Dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dioate |
| Formula |
C30 H38 O4 S2 |
| Calculated formula |
C30 H38 O4 S2 |
| SMILES |
CCCCCCc1ccc(s1)c1cc(C(=O)OC)c(cc1C(=O)OC)c1ccc(s1)CCCCCC |
| Title of publication |
Dimethyl 2,5-bis(5-hexylthiophen-2-yl)benzene-1,4-dioate |
| Authors of publication |
Song, Cheng-Li; Liu, Ke; Zhang, Ai-Jiang; Xu, Zhu-Guo; Zhang, Hao-Li |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o1059 |
| a |
15.617 ± 0.006 Å |
| b |
8.083 ± 0.003 Å |
| c |
11.585 ± 0.004 Å |
| α |
90° |
| β |
104.47 ± 0.004° |
| γ |
90° |
| Cell volume |
1416 ± 0.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
13 |
| Hermann-Mauguin space group symbol |
P 1 2/c 1 |
| Hall space group symbol |
-P 2yc |
| Residual factor for all reflections |
0.0593 |
| Residual factor for significantly intense reflections |
0.0412 |
| Weighted residual factors for significantly intense reflections |
0.0943 |
| Weighted residual factors for all reflections included in the refinement |
0.1042 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.04 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230087.html