Information card for entry 2230134
| Chemical name |
5-<i>tert</i>-Butyl 1-ethyl 3-amino-1,4,5,6-tetrahydropyrrolo[3,4-<i>c</i>]pyrazole-1,5-dicarboxylate |
| Formula |
C13 H20 N4 O4 |
| Calculated formula |
C13 H20 N4 O4 |
| SMILES |
CCOC(=O)n1nc(c2c1CN(C2)C(=O)OC(C)(C)C)N |
| Title of publication |
5-<i>tert</i>-Butyl 1-ethyl 3-amino-1,4,5,6-tetrahydropyrrolo[3,4-<i>c</i>]pyrazole-1,5-dicarboxylate |
| Authors of publication |
Xia, Wen-Bin; Bai, Xiao-Guang; Liu, Hong-Tao; Wang, Ju-Xian |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
5 |
| Pages of publication |
o1150 |
| a |
10.772 ± 0.003 Å |
| b |
12.18 ± 0.004 Å |
| c |
12.986 ± 0.004 Å |
| α |
70.845 ± 0.005° |
| β |
65.875 ± 0.004° |
| γ |
85.821 ± 0.005° |
| Cell volume |
1465.2 ± 0.8 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0655 |
| Residual factor for significantly intense reflections |
0.0473 |
| Weighted residual factors for significantly intense reflections |
0.1164 |
| Weighted residual factors for all reflections included in the refinement |
0.1281 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230134.html