Information card for entry 2230333
| Chemical name |
(3<i>R</i>*,3a<i>R</i>*)-3-(3-furanyl)-3a,4,5,6- tetrahydro-3a,7-dimethyl-2-benzofuran-1(3<i>H</i>)-one |
| Formula |
C14 H16 O3 |
| Calculated formula |
C14 H16 O3 |
| SMILES |
O=C1O[C@H]([C@]2(C1=C(CCC2)C)C)c1cocc1 |
| Title of publication |
Fraxinellone |
| Authors of publication |
Gu, Hong-Mei; Xu, Hao; Zhong, Zhao-Zhao; Zhu, Hai-Liang; Li, Qing-Shan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1472 |
| a |
5.94 ± 0.003 Å |
| b |
12.661 ± 0.006 Å |
| c |
15.921 ± 0.007 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1197.4 ± 1 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0651 |
| Residual factor for significantly intense reflections |
0.0458 |
| Weighted residual factors for significantly intense reflections |
0.1034 |
| Weighted residual factors for all reflections included in the refinement |
0.1125 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230333.html