Information card for entry 2230352
| Common name |
6,7-Dimethoxy-3-methoxycarbonyl-1-(2-methoxyphenyl)-3,4-dihydroisoquinoline 2-oxide |
| Chemical name |
6,7-dimethoxy-3-(methoxycarbonyl)-1-(2-methoxyphenyl)- 3,4-dihydroisoquinolin-2-ium-2-olate |
| Formula |
C20 H21 N O6 |
| Calculated formula |
C20 H21 N O6 |
| SMILES |
O=N1=C(c2cc(OC)c(OC)cc2CC1C(=O)OC)c1ccccc1OC |
| Title of publication |
6,7-Dimethoxy-3-methoxycarbonyl-1-(2-methoxyphenyl)-3,4-dihydroisoquinoline 2-oxide |
| Authors of publication |
Naicker, Tricia; Govender, Thavendran; Kruger, Hendrik G.; Maguire, Glenn E. M. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1352 |
| a |
5.4765 ± 0.0001 Å |
| b |
21.9984 ± 0.0006 Å |
| c |
15.0007 ± 0.0004 Å |
| α |
90° |
| β |
92.774 ± 0.002° |
| γ |
90° |
| Cell volume |
1805.08 ± 0.08 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0705 |
| Residual factor for significantly intense reflections |
0.0531 |
| Weighted residual factors for significantly intense reflections |
0.1443 |
| Weighted residual factors for all reflections included in the refinement |
0.1566 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230352.html