Information card for entry 2230369
| Chemical name |
2-(2-Iodophenyl)-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile |
| Formula |
C16 H13 I N2 |
| Calculated formula |
C16 H13 I N2 |
| SMILES |
c12ccccc1C(C#N)N(CC2)c1c(cccc1)I |
| Title of publication |
2-(2-Iodophenyl)-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile |
| Authors of publication |
Ma, Yanni; Sun, Yifang; Zheng, Feng; Sun, Wenwen; Zhou, Le |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1484 |
| a |
11.7607 ± 0.0012 Å |
| b |
8.4473 ± 0.0009 Å |
| c |
15.2601 ± 0.0015 Å |
| α |
90° |
| β |
107.662 ± 0.001° |
| γ |
90° |
| Cell volume |
1444.6 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.04 |
| Residual factor for significantly intense reflections |
0.0347 |
| Weighted residual factors for significantly intense reflections |
0.0962 |
| Weighted residual factors for all reflections included in the refinement |
0.1014 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.015 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230369.html