Information card for entry 2230424
| Chemical name |
2-[4-(Methylsulfanyl)phenyl]naphtho[1,8-<i>de</i>][1,3,2]diazaborinane |
| Formula |
C17 H15 B N2 S |
| Calculated formula |
C17 H15 B N2 S |
| SMILES |
S(c1ccc(cc1)B1Nc2cccc3cccc(N1)c23)C |
| Title of publication |
2-[4-(Methylsulfanyl)phenyl]naphtho[1,8-<i>de</i>][1,3,2]diazaborinane |
| Authors of publication |
Slabber, Cathryn A.; Akerman, Matthew P.; Robinson, Ross S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1338 |
| a |
13.7594 ± 0.0006 Å |
| b |
9.0545 ± 0.0003 Å |
| c |
12.783 ± 0.0005 Å |
| α |
90° |
| β |
113.411 ± 0.005° |
| γ |
90° |
| Cell volume |
1461.46 ± 0.11 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0868 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for significantly intense reflections |
0.1347 |
| Weighted residual factors for all reflections included in the refinement |
0.1491 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.981 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230424.html