Information card for entry 2230461
| Chemical name |
5-(3,4-Dimethylbenzylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Formula |
C15 H16 O4 |
| Calculated formula |
C15 H16 O4 |
| SMILES |
O1C(=O)C(=Cc2cc(c(cc2)C)C)C(=O)OC1(C)C |
| Title of publication |
5-(3,4-Dimethylbenzylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| Authors of publication |
Zeng, Wu-Lan |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
6 |
| Pages of publication |
o1351 |
| a |
16.8249 ± 0.0015 Å |
| b |
7.139 ± 0.0006 Å |
| c |
11.7101 ± 0.0011 Å |
| α |
90° |
| β |
108.612 ± 0.001° |
| γ |
90° |
| Cell volume |
1333 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1017 |
| Residual factor for significantly intense reflections |
0.0482 |
| Weighted residual factors for significantly intense reflections |
0.1398 |
| Weighted residual factors for all reflections included in the refinement |
0.2007 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.086 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230461.html