Information card for entry 2230596
| Chemical name |
3,6,8-Trihydroxy-3,4,5,7-tetramethyl-3,4-dihydroisocoumarin |
| Formula |
C13 H16 O5 |
| Calculated formula |
C13 H16 O5 |
| SMILES |
O1C(=O)c2c(O)c(c(O)c(c2[C@H](C)[C@]1(O)C)C)C |
| Title of publication |
3,6,8-Trihydroxy-3,4,5,7-tetramethyl-3,4-dihydroisocoumarin |
| Authors of publication |
Tao, Yi-Wen; Wang, Yun |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1675 |
| a |
7.4731 ± 0.0003 Å |
| b |
9.9742 ± 0.0007 Å |
| c |
16.4066 ± 0.0012 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1222.92 ± 0.13 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0253 |
| Residual factor for significantly intense reflections |
0.0248 |
| Weighted residual factors for significantly intense reflections |
0.0688 |
| Weighted residual factors for all reflections included in the refinement |
0.0694 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.065 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230596.html