Information card for entry 2230760
| Chemical name |
3-Nitroso-2,4,6,8-tetraphenyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
| Formula |
C31 H27 N3 O2 |
| Calculated formula |
C31 H27 N3 O2 |
| SMILES |
O=C1[C@H]2[C@@H](N[C@@H]([C@@H]1[C@H](N(N=O)[C@H]2c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
3-Nitroso-2,4,6,8-tetraphenyl-3,7-diazabicyclo[3.3.1]nonan-9-one |
| Authors of publication |
Natarajan, Sampath; Mathews, Rita |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1686 |
| a |
18.723 ± 0.004 Å |
| b |
8.8319 ± 0.0017 Å |
| c |
15.806 ± 0.003 Å |
| α |
90° |
| β |
104.728 ± 0.003° |
| γ |
90° |
| Cell volume |
2527.8 ± 0.9 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1451 |
| Residual factor for significantly intense reflections |
0.0811 |
| Weighted residual factors for significantly intense reflections |
0.1606 |
| Weighted residual factors for all reflections included in the refinement |
0.1873 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.056 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230760.html