Information card for entry 2230825
| Chemical name |
1,3-Bis(4-<i>tert</i>-butylbenzyl)pyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Formula |
C26 H32 N2 O2 |
| Calculated formula |
C26 H32 N2 O2 |
| SMILES |
O=C1C=CN(C(=O)N1Cc1ccc(cc1)C(C)(C)C)Cc1ccc(cc1)C(C)(C)C |
| Title of publication |
1,3-Bis(4-<i>tert</i>-butylbenzyl)pyrimidine-2,4(1<i>H</i>,3<i>H</i>)-dione |
| Authors of publication |
Li, Gong-Chun; Wang, Hong-Sheng; Zhu, Feng-Xiang; Niu, Yu-Jiao |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1608 |
| a |
7.5742 ± 0.0018 Å |
| b |
12.191 ± 0.003 Å |
| c |
13.08 ± 0.003 Å |
| α |
88.643 ± 0.004° |
| β |
84.809 ± 0.004° |
| γ |
78.381 ± 0.004° |
| Cell volume |
1178.1 ± 0.5 Å3 |
| Cell temperature |
294 ± 2 K |
| Ambient diffraction temperature |
294 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0923 |
| Residual factor for significantly intense reflections |
0.0563 |
| Weighted residual factors for significantly intense reflections |
0.1621 |
| Weighted residual factors for all reflections included in the refinement |
0.1981 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.085 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230825.html