Information card for entry 2230874
| Chemical name |
Tetramethyl 5,5'-[4,5-dicyano-1,2-phenylenebis(oxy)]diisophthalate chloroform monosolvate |
| Formula |
C29 H21 Cl3 N2 O10 |
| Calculated formula |
C29 H21 Cl3 N2 O10 |
| SMILES |
ClC(Cl)Cl.O(c1c(Oc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(c(c1)C#N)C#N)c1cc(C(=O)OC)cc(C(=O)OC)c1 |
| Title of publication |
Tetramethyl 5,5'-[4,5-dicyano-1,2-phenylenebis(oxy)]diisophthalate chloroform monosolvate |
| Authors of publication |
Yang, Fei; Meng, Fanjun; Zhang, Xiaomei; Bai, Ming |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1836 |
| a |
9.9223 ± 0.0013 Å |
| b |
11.4374 ± 0.0015 Å |
| c |
13.9398 ± 0.0019 Å |
| α |
96.86 ± 0.002° |
| β |
94.578 ± 0.002° |
| γ |
105.326 ± 0.002° |
| Cell volume |
1504.5 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0853 |
| Residual factor for significantly intense reflections |
0.0555 |
| Weighted residual factors for significantly intense reflections |
0.1428 |
| Weighted residual factors for all reflections included in the refinement |
0.1587 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.075 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230874.html