Information card for entry 2230877
| Common name |
1-Bromo-2,3,5,6-tetrafluoro-4-nitrobenzene |
| Chemical name |
1-Bromo-2,3,5,6-tetrafluoro-4-nitrobenzene |
| Formula |
C6 Br F4 N O2 |
| Calculated formula |
C6 Br F4 N O2 |
| SMILES |
Brc1c(c(c(c(c1F)F)N(=O)=O)F)F |
| Title of publication |
1-Bromo-2,3,5,6-tetrafluoro-4-nitrobenzene |
| Authors of publication |
Stein, Mario; Schwarzer, Anke; Hulliger, Jürg; Weber, Edwin |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1655 |
| a |
5.6718 ± 0.0003 Å |
| b |
10.9476 ± 0.0006 Å |
| c |
12.2652 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
761.58 ± 0.08 Å3 |
| Cell temperature |
93 ± 2 K |
| Ambient diffraction temperature |
93 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0254 |
| Residual factor for significantly intense reflections |
0.0227 |
| Weighted residual factors for significantly intense reflections |
0.0522 |
| Weighted residual factors for all reflections included in the refinement |
0.0529 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.002 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230877.html