Information card for entry 2230921
| Common name |
3,5-Dimethyl-1-(4-sulfamidophenyl)-7-oxothiazol[4,5-d]pyradazine |
| Chemical name |
4-(2,7-dimethyl-4-oxo-1,3-thiazolo[4,5-<i>d</i>]pyridazin- 5-yl)benzenesulfonamide |
| Formula |
C13 H12 N4 O3 S2 |
| Calculated formula |
C13 H12 N4 O3 S2 |
| SMILES |
s1c(C)nc2c1c(nn(c2=O)c1ccc(S(=O)(=O)N)cc1)C |
| Title of publication |
4-(2,7-Dimethyl-4-oxo-1,3-thiazolo[4,5-<i>d</i>]pyridazin-5-yl)benzenesulfonamide |
| Authors of publication |
Asiri, Abdullah M.; Faidallah, Hassan M.; Ng, Seik Weng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
7 |
| Pages of publication |
o1665 |
| a |
12.6048 ± 0.001 Å |
| b |
13.2273 ± 0.001 Å |
| c |
8.9703 ± 0.0007 Å |
| α |
90° |
| β |
102.242 ± 0.001° |
| γ |
90° |
| Cell volume |
1461.6 ± 0.2 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0406 |
| Residual factor for significantly intense reflections |
0.0344 |
| Weighted residual factors for significantly intense reflections |
0.0909 |
| Weighted residual factors for all reflections included in the refinement |
0.0965 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2230921.html