Information card for entry 2231167
| Chemical name |
3-{1-[4-(2-Methylpropyl)phenyl]ethyl}-4-phenyl-1<i>H</i>- 1,2,4-triazole-5(4<i>H</i>)-thione |
| Formula |
C20 H23 N3 S |
| Calculated formula |
C20 H23 N3 S |
| SMILES |
S=C1N(c2ccccc2)C(=NN1)C(c1ccc(cc1)CC(C)C)C |
| Title of publication |
3-{1-[4-(2-Methylpropyl)phenyl]ethyl}-4-phenyl-1<i>H</i>-1,2,4-triazole-5(4<i>H</i>)-thione |
| Authors of publication |
Fun, Hoong-Kun; Yeap, Chin Sing; Manjunath, K.; Prasad, D. Jagadeesh; Poojary, Boja |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
8 |
| Pages of publication |
o1943 |
| a |
6.3249 ± 0.0002 Å |
| b |
12.4958 ± 0.0005 Å |
| c |
12.9125 ± 0.0004 Å |
| α |
77.649 ± 0.001° |
| β |
78.133 ± 0.001° |
| γ |
76.551 ± 0.001° |
| Cell volume |
956.44 ± 0.06 Å3 |
| Cell temperature |
297 ± 2 K |
| Ambient diffraction temperature |
297 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0897 |
| Residual factor for significantly intense reflections |
0.0548 |
| Weighted residual factors for significantly intense reflections |
0.1608 |
| Weighted residual factors for all reflections included in the refinement |
0.1902 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.054 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231167.html