Information card for entry 2231396
| Chemical name |
Di-μ-acetato- κ^3^<i>O</i>,<i>O</i>':<i>O</i>';κ^3^<i>O</i>:<i>O</i>,<i>O</i>'- bis[(acetato-κ^2^<i>O</i>,<i>O</i>')bis(5-nitro-1,10-phenanthroline- κ^2^<i>N</i>,<i>N</i>')cadmium] |
| Formula |
C32 H26 Cd2 N6 O12 |
| Calculated formula |
C32 H26 Cd2 N6 O12 |
| SMILES |
[Cd]1234([O]=C(O1)C)([O]=C([O]2[Cd]125([O]3C(=[O]1)C)([O]=C(O2)C)[n]1cccc2c(N(=O)=O)cc3ccc[n]5c3c12)C)[n]1cccc2cc(N(=O)=O)c3ccc[n]4c3c12 |
| Title of publication |
Di-μ-acetato-κ^3^<i>O</i>,<i>O</i>':<i>O</i>';κ^3^<i>O</i>:<i>O</i>,<i>O</i>'-bis[(acetato-κ^2^<i>O</i>,<i>O</i>')bis(5-nitro-1,10-phenanthroline-κ^2^<i>N</i>,<i>N</i>')cadmium] |
| Authors of publication |
Cui, Fenghua; Zhang, Shuxia |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
m1247 |
| a |
18.653 ± 0.003 Å |
| b |
11.2236 ± 0.0016 Å |
| c |
15.51 ± 0.002 Å |
| α |
90° |
| β |
94.531 ± 0.002° |
| γ |
90° |
| Cell volume |
3236.9 ± 0.8 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.035 |
| Residual factor for significantly intense reflections |
0.0248 |
| Weighted residual factors for significantly intense reflections |
0.052 |
| Weighted residual factors for all reflections included in the refinement |
0.0567 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.02 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231396.html