Information card for entry 2231421
| Chemical name |
2,4-Bis(morpholin-4-yl)-6-phenoxy-1,3,5-triazine |
| Formula |
C17 H21 N5 O3 |
| Calculated formula |
C17 H21 N5 O3 |
| SMILES |
O1CCN(CC1)c1nc(nc(n1)N1CCOCC1)Oc1ccccc1 |
| Title of publication |
2,4-Bis(morpholin-4-yl)-6-phenoxy-1,3,5-triazine |
| Authors of publication |
Vennila, Jasmine P.; Thiruvadigal, D. John; Kavitha, Helen P.; Chakkaravarthi, G.; Manivannan, V. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2451 |
| a |
8.6788 ± 0.0005 Å |
| b |
11.2461 ± 0.0005 Å |
| c |
17.9778 ± 0.001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1754.68 ± 0.16 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0542 |
| Residual factor for significantly intense reflections |
0.041 |
| Weighted residual factors for significantly intense reflections |
0.1054 |
| Weighted residual factors for all reflections included in the refinement |
0.1154 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.047 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231421.html