Information card for entry 2231432
| Chemical name |
<i>N</i>,<i>N</i>'-Bis(2,3-dimethoxybenzylidene)ethane-1,2-diamine |
| Formula |
C20 H24 N2 O4 |
| Calculated formula |
C20 H24 N2 O4 |
| SMILES |
COc1c(cccc1OC)/C=N/CC/N=C/c1cccc(c1OC)OC |
| Title of publication |
<i>N</i>,<i>N</i>'-Bis(2,3-dimethoxybenzylidene)ethane-1,2-diamine |
| Authors of publication |
Xue, Hua; Li, Wenjuan; Han, Hongfei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2431 |
| a |
5.0491 ± 0.0005 Å |
| b |
13.5803 ± 0.0015 Å |
| c |
13.5803 ± 0.0015 Å |
| α |
89.866 ± 0.002° |
| β |
88.863 ± 0.001° |
| γ |
88.863 ± 0.001° |
| Cell volume |
930.81 ± 0.17 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1106 |
| Residual factor for significantly intense reflections |
0.0619 |
| Weighted residual factors for significantly intense reflections |
0.1506 |
| Weighted residual factors for all reflections included in the refinement |
0.1838 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231432.html
