Information card for entry 2231773
| Chemical name |
9-Hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14- dioxatricyclo[9.3.0.0^2,4^]tetradec-7-en-13-one |
| Formula |
C19 H29 N O4 |
| Calculated formula |
C19 H29 N O4 |
| SMILES |
[C@@H]12[C@@](CCC=C([C@H](C[C@H]3[C@H]1OC(=O)[C@@H]3CN1CCCC1)O)C)(C)O2 |
| Title of publication |
9-Hydroxy-4,8-dimethyl-12-(pyrrolidin-1-ylmethyl)-3,14-dioxatricyclo[9.3.0.0^2,4^]tetradec-7-en-13-one |
| Authors of publication |
Moumou, Mohamed; Benharref, Ahmed; Avignant, Daniel; Oudahmane, Abdelghani; Akssira, Mohamed; Berraho, Moha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2226 - o2227 |
| a |
8.1389 ± 0.0006 Å |
| b |
10.1788 ± 0.0007 Å |
| c |
21.7669 ± 0.0015 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1803.3 ± 0.2 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.1025 |
| Residual factor for significantly intense reflections |
0.0448 |
| Weighted residual factors for significantly intense reflections |
0.0961 |
| Weighted residual factors for all reflections included in the refinement |
0.1211 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231773.html