Information card for entry 2231777
| Chemical name |
Dimethyl 4-(4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine- 3,5-dicarboxylate |
| Formula |
C17 H19 N O5 |
| Calculated formula |
C17 H19 N O5 |
| SMILES |
N1C(=C(C(c2ccc(O)cc2)C(=C1C)C(=O)OC)C(=O)OC)C |
| Title of publication |
Dimethyl 4-(4-hydroxyphenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Zhang, Chun-Hua; Zhao, Jing-Min; Chen, Bao-Guo |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
9 |
| Pages of publication |
o2362 - o2363 |
| a |
13.245 ± 0.003 Å |
| b |
9.348 ± 0.0019 Å |
| c |
13.754 ± 0.003 Å |
| α |
90° |
| β |
110.14 ± 0.03° |
| γ |
90° |
| Cell volume |
1598.8 ± 0.7 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.2507 |
| Residual factor for significantly intense reflections |
0.0735 |
| Weighted residual factors for significantly intense reflections |
0.0552 |
| Weighted residual factors for all reflections included in the refinement |
0.0805 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231777.html