Information card for entry 2231797
| Chemical name |
6-Benzyl-2-[(triphenyl-λ^5^-phosphanylidene)amino]-4,5,6,7- tetrahydrothieno[2,3-<i>c</i>]pyridine-3-carbonitrile |
| Formula |
C33 H28 N3 P S |
| Calculated formula |
C33 H28 N3 P S |
| SMILES |
s1c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(c2CCN(Cc12)Cc1ccccc1)C#N |
| Title of publication |
6-Benzyl-2-[(triphenyl-λ^5^-phosphanylidene)amino]-4,5,6,7-tetrahydrothieno[2,3-<i>c</i>]pyridine-3-carbonitrile |
| Authors of publication |
Chen, Hong; Yan, Kai |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2548 |
| a |
8.926 ± 0.004 Å |
| b |
27.537 ± 0.012 Å |
| c |
11.719 ± 0.005 Å |
| α |
90° |
| β |
101.97 ± 0.004° |
| γ |
90° |
| Cell volume |
2818 ± 2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0628 |
| Residual factor for significantly intense reflections |
0.0537 |
| Weighted residual factors for significantly intense reflections |
0.1372 |
| Weighted residual factors for all reflections included in the refinement |
0.1446 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.088 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231797.html