Information card for entry 2231843
| Chemical name |
1-Heptyl-1,3,6,8-tetraazatricyclo[4.3.1.1^3,8^]undecan-1-ium iodide |
| Formula |
C14 H29 I N4 |
| Calculated formula |
C14 H29 I N4 |
| SMILES |
C1[N+]2(CN3CN(C2)CN1CC3)CCCCCCC.[I-] |
| Title of publication |
1-Heptyl-1,3,6,8-tetraazatricyclo[4.3.1.1^3,8^]undecan-1-ium iodide |
| Authors of publication |
Rivera, Augusto; Sadat-Bernal, John; Ríos-Motta, Jaime; Fejfarová, Karla; Dušek, Michal |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2629 |
| a |
8.8325 ± 0.0002 Å |
| b |
15.3276 ± 0.0003 Å |
| c |
12.4792 ± 0.0002 Å |
| α |
90° |
| β |
100.072 ± 0.002° |
| γ |
90° |
| Cell volume |
1663.41 ± 0.06 Å3 |
| Cell temperature |
160 K |
| Ambient diffraction temperature |
160 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0375 |
| Residual factor for significantly intense reflections |
0.0273 |
| Weighted residual factors for significantly intense reflections |
0.061 |
| Weighted residual factors for all reflections included in the refinement |
0.0649 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.61 |
| Diffraction radiation wavelength |
0.7107 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231843.html