Information card for entry 2231913
| Common name |
4,4'-Difluorobenzhydryl piperazinium picrate |
| Chemical name |
4-[bis(4-fluorophenyl)methyl]piperazin-1-ium 2,4,6-trinitrophenolate |
| Formula |
C23 H21 F2 N5 O7 |
| Calculated formula |
C23 H21 F2 N5 O7 |
| SMILES |
Fc1ccc(C(N2CC[NH2+]CC2)c2ccc(F)cc2)cc1.[O-]c1c(cc(N(=O)=O)cc1N(=O)=O)N(=O)=O |
| Title of publication |
4-[Bis(4-fluorophenyl)methyl]piperazin-1-ium picrate |
| Authors of publication |
Betz, Richard; Gerber, Thomas; Hosten, Eric; Dayananda, Alaloor S.; Yathirajan, Hemmige S.; Narayana, Badiadka |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2587 - o2588 |
| a |
8.9425 ± 0.0002 Å |
| b |
11.8286 ± 0.0002 Å |
| c |
23.0922 ± 0.0004 Å |
| α |
90° |
| β |
105.72 ± 0.001° |
| γ |
90° |
| Cell volume |
2351.27 ± 0.08 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0454 |
| Residual factor for significantly intense reflections |
0.0392 |
| Weighted residual factors for significantly intense reflections |
0.1044 |
| Weighted residual factors for all reflections included in the refinement |
0.1107 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231913.html