Information card for entry 2231918
| Chemical name |
Diiodido(1,10-phenanthroline-5,6-dione-κ^2^<i>N</i>,<i>N</i>')mercury(II) |
| Formula |
C12 H6 Hg I2 N2 O2 |
| Calculated formula |
C12 H6 Hg I2 N2 O2 |
| SMILES |
[Hg]1(I)(I)[n]2cccc3c2c2[n]1cccc2C(=O)C3=O |
| Title of publication |
Diiodido(1,10-phenanthroline-5,6-dione-κ^2^<i>N</i>,<i>N</i>')mercury(II) |
| Authors of publication |
Ghaemi, Akbar; Shojaiean, Rezvan; Ng, Seik Weng; Tiekink, Edward R. T. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
m1449 - m1450 |
| a |
11.7941 ± 0.0003 Å |
| b |
8.1725 ± 0.0001 Å |
| c |
15.3982 ± 0.0003 Å |
| α |
90° |
| β |
108.298 ± 0.002° |
| γ |
90° |
| Cell volume |
1409.14 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.0228 |
| Residual factor for significantly intense reflections |
0.0221 |
| Weighted residual factors for significantly intense reflections |
0.0489 |
| Weighted residual factors for all reflections included in the refinement |
0.0493 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.027 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2231918.html