Information card for entry 2232097
| Common name |
2,3-dihydropyrazine |
| Chemical name |
2-(2-Chlorophenyl)-3-methyl-5,6-diphenyl-2,3-dihydropyrazine |
| Formula |
C23 H19 Cl N2 |
| Calculated formula |
C23 H19 Cl N2 |
| SMILES |
Clc1ccccc1[C@H]1N=C(c2ccccc2)C(=N[C@@H]1C)c1ccccc1.Clc1ccccc1[C@@H]1N=C(c2ccccc2)C(=N[C@H]1C)c1ccccc1 |
| Title of publication |
2-(2-Chlorophenyl)-3-methyl-5,6-diphenyl-2,3-dihydropyrazine |
| Authors of publication |
Anuradha, N.; Chitra, S.; Thiruvalluvar, A.; Pandiarajan, K.; Butcher, R. J.; Jasinski, J. P.; Golen, J. A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2598 |
| a |
10.5675 ± 0.0008 Å |
| b |
19.7014 ± 0.0009 Å |
| c |
10.4207 ± 0.0007 Å |
| α |
90° |
| β |
118.479 ± 0.009° |
| γ |
90° |
| Cell volume |
1907 ± 0.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0618 |
| Residual factor for significantly intense reflections |
0.0515 |
| Weighted residual factors for significantly intense reflections |
0.1405 |
| Weighted residual factors for all reflections included in the refinement |
0.1501 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232097.html