Information card for entry 2232135
| Chemical name |
<i>rac</i>-3-{4-[(Furan-2-ylmethylidene)amino]-3-methyl-5-sulfanylidene- 4,5-dihydro-1<i>H</i>-1,2,4-triazol-1-yl}-1,3-diphenylpropan-1-one |
| Formula |
C23 H20 N4 O2 S |
| Calculated formula |
C23 H20 N4 O2 S |
| SMILES |
S=C1N(N=C(N1/N=C/c1occc1)C)C(CC(=O)c1ccccc1)c1ccccc1 |
| Title of publication |
<i>rac</i>-3-{4-[(Furan-2-ylmethylidene)amino]-3-methyl-5-sulfanylidene-4,5-dihydro-1<i>H</i>-1,2,4-triazol-1-yl}-1,3-diphenylpropan-1-one |
| Authors of publication |
Wang, Wei; Gao, Yan; Wu, Wen-peng; Xu, Chao; Liu, Qing-lei |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
10 |
| Pages of publication |
o2728 |
| a |
8.154 ± 0.003 Å |
| b |
21.194 ± 0.006 Å |
| c |
12.878 ± 0.004 Å |
| α |
90° |
| β |
107.965 ± 0.005° |
| γ |
90° |
| Cell volume |
2117 ± 1.2 Å3 |
| Cell temperature |
113 ± 2 K |
| Ambient diffraction temperature |
113 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.0397 |
| Weighted residual factors for significantly intense reflections |
0.1019 |
| Weighted residual factors for all reflections included in the refinement |
0.106 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.074 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232135.html