Information card for entry 2232241
| Chemical name |
10α-Hydroxy-4,9-dimethyl-13-(pipyridin-1-ylmethyl)-3,8,15- trioxatetracyclo[10.3.0.0^2,4^.0^7,9^]tetradecan-14-one |
| Formula |
C20 H31 N O5 |
| Calculated formula |
C20 H31 N O5 |
| SMILES |
[C@H]12[C@H]3[C@@](CC[C@H]4[C@@]([C@H](C[C@@H]1[C@H](C(=O)O2)CN1CCCCC1)O)(C)O4)(C)O3 |
| Title of publication |
10α-Hydroxy-4,9-dimethyl-13-(pipyridin-1-ylmethyl)-3,8,15-trioxatetracyclo[10.3.0.0^2,4^.0^7,9^]tetradecan-14-one |
| Authors of publication |
Moumou, Mohamed; Benharref, Ahmed; Oudahmane, Abdelghani; Elhakmaoui, Ahmed; Berraho, Moha |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o3003 - o3004 |
| a |
8.0899 ± 0.0005 Å |
| b |
10.7562 ± 0.0006 Å |
| c |
22.5093 ± 0.0013 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1958.7 ± 0.2 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0611 |
| Residual factor for significantly intense reflections |
0.0355 |
| Weighted residual factors for significantly intense reflections |
0.0753 |
| Weighted residual factors for all reflections included in the refinement |
0.0866 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232241.html