Information card for entry 2232251
| Chemical name |
Diisopropyl 1-(4-methoxyphenyl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4- dihydropyridine-3,5-dicarboxylate |
| Formula |
C28 H32 N2 O7 |
| Calculated formula |
C28 H32 N2 O7 |
| SMILES |
N1(C(=C(C(C(=C1C)C(=O)OC(C)C)c1cc(ccc1)N(=O)=O)C(=O)OC(C)C)C)c1ccc(cc1)OC |
| Title of publication |
Diisopropyl 1-(4-methoxyphenyl)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Kapoor, Kamini; Gupta, Vivek K.; Kant, Rajni; Pawar, Milind P.; Joshi, Hitendra S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2979 |
| a |
9.5043 ± 0.0008 Å |
| b |
10.757 ± 0.0007 Å |
| c |
15.1279 ± 0.0012 Å |
| α |
90.501 ± 0.006° |
| β |
105.873 ± 0.007° |
| γ |
114.601 ± 0.007° |
| Cell volume |
1339.3 ± 0.2 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1368 |
| Residual factor for significantly intense reflections |
0.0691 |
| Weighted residual factors for significantly intense reflections |
0.17 |
| Weighted residual factors for all reflections included in the refinement |
0.2034 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.933 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232251.html