Information card for entry 2232281
| Chemical name |
(5<i>E</i>)-5-(2,4-Dichlorobenzylidene)-2-(piperidin-1-yl)- 1,3-thiazol-4(5<i>H</i>)-one |
| Formula |
C15 H14 Cl2 N2 O S |
| Calculated formula |
C15 H14 Cl2 N2 O S |
| SMILES |
Clc1ccc(c(Cl)c1)/C=C1\SC(=NC1=O)N1CCCCC1 |
| Title of publication |
(5<i>E</i>)-5-(2,4-Dichlorobenzylidene)-2-(piperidin-1-yl)-1,3-thiazol-4(5<i>H</i>)-one |
| Authors of publication |
Fun, Hoong-Kun; Hemamalini, Madhukar; Lobo, Prajwal L.; Prasad, D. Jagadeesh; Poojary, Boja |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2884 |
| a |
28.5303 ± 0.0003 Å |
| b |
7.4915 ± 0.0001 Å |
| c |
15.4789 ± 0.0002 Å |
| α |
90° |
| β |
116.407 ± 0.001° |
| γ |
90° |
| Cell volume |
2963.17 ± 0.07 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
6 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0303 |
| Residual factor for significantly intense reflections |
0.0261 |
| Weighted residual factors for significantly intense reflections |
0.0713 |
| Weighted residual factors for all reflections included in the refinement |
0.074 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232281.html