Information card for entry 2232398
| Common name |
opipramol dihydrochloride |
| Chemical name |
4-{3-[2-azatricyclo[9.4.0.0^3,8^]pentadeca-1(15),3,5,7,11,13-\ hexaen-2-yl]propyl}-1-(2-hydroxyethyl)piperazine-1,4-diium dichloride |
| Formula |
C23 H31 Cl2 N3 O |
| Calculated formula |
C23 H31 Cl2 N3 O |
| SMILES |
OCC[NH+]1CC[NH+](CCCN2c3c(C=Cc4c2cccc4)cccc3)CC1.[Cl-].[Cl-] |
| Title of publication |
Opipramol dihydrochloride |
| Authors of publication |
Betz, Richard; Gerber, Thomas; Hosten, Eric; Siddaraju, Budanoor P.; Yathirajan, Hemmige S. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o2994 - o2995 |
| a |
33.6581 ± 0.0006 Å |
| b |
9.4265 ± 0.0002 Å |
| c |
6.8978 ± 0.0001 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2188.52 ± 0.07 Å3 |
| Cell temperature |
200 ± 2 K |
| Ambient diffraction temperature |
200 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0312 |
| Residual factor for significantly intense reflections |
0.0274 |
| Weighted residual factors for significantly intense reflections |
0.0692 |
| Weighted residual factors for all reflections included in the refinement |
0.0711 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.031 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232398.html