Information card for entry 2232470
| Chemical name |
(<i>E</i>,<i>E</i>)-<i>N</i>^1^,<i>N</i>^2^-Bis(2,6-difluorobenzylidene)ethane-1,2-diamine |
| Formula |
C16 H12 F4 N2 |
| Calculated formula |
C16 H12 F4 N2 |
| SMILES |
Fc1cccc(c1/C=N/CC/N=C/c1c(F)cccc1F)F |
| Title of publication |
(<i>E</i>,<i>E</i>)-<i>N</i>^1^,<i>N</i>^2^-Bis(2,6-difluorobenzylidene)ethane-1,2-diamine |
| Authors of publication |
Khaledi, Mohammad; Kia, Reza; Clegg, William; Harrington, Ross W. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
11 |
| Pages of publication |
o3107 |
| a |
7.3304 ± 0.001 Å |
| b |
10.5414 ± 0.0015 Å |
| c |
9.2106 ± 0.0013 Å |
| α |
90° |
| β |
105.487 ± 0.002° |
| γ |
90° |
| Cell volume |
685.89 ± 0.17 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.049 |
| Residual factor for significantly intense reflections |
0.0431 |
| Weighted residual factors for significantly intense reflections |
0.1176 |
| Weighted residual factors for all reflections included in the refinement |
0.1241 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.151 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232470.html