Information card for entry 2232612
| Chemical name |
<i>N</i>,<i>N</i>'-Dimethyl-<i>N</i>,<i>N</i>'-bis(pyridin-2-yl)methanediamine |
| Formula |
C13 H16 N4 |
| Calculated formula |
C13 H16 N4 |
| SMILES |
n1ccccc1N(C)CN(C)c1ncccc1 |
| Title of publication |
<i>N</i>,<i>N</i>'-Dimethyl-<i>N</i>,<i>N</i>'-bis(pyridin-2-yl)methanediamine |
| Authors of publication |
Lee, Moon-Sun; Yoon, Minyoung; Yang, O-bong; Lee, Dong-Heon; Park, Gyungse |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3226 |
| a |
11.6652 ± 0.0007 Å |
| b |
8.3921 ± 0.0005 Å |
| c |
12.8966 ± 0.0007 Å |
| α |
90° |
| β |
106.634 ± 0.002° |
| γ |
90° |
| Cell volume |
1209.69 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0467 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for significantly intense reflections |
0.1156 |
| Weighted residual factors for all reflections included in the refinement |
0.125 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.963 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232612.html