Information card for entry 2232752
| Chemical name |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetraethylpyridine-2,6-dicarboxamide |
| Formula |
C15 H23 N3 O2 |
| Calculated formula |
C15 H23 N3 O2 |
| SMILES |
c1(cccc(C(=O)N(CC)CC)n1)C(=O)N(CC)CC |
| Title of publication |
<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetraethylpyridine-2,6-dicarboxamide |
| Authors of publication |
Pojarová, Michaela; Dušek, Michal; Makrlík, Emanuel; Babain, Vasily A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3197 |
| a |
11.1919 ± 0.0003 Å |
| b |
11.7913 ± 0.0003 Å |
| c |
12.2774 ± 0.0003 Å |
| α |
90.255 ± 0.002° |
| β |
105.05 ± 0.002° |
| γ |
102.6 ± 0.002° |
| Cell volume |
1523.75 ± 0.07 Å3 |
| Cell temperature |
120 K |
| Ambient diffraction temperature |
120 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.035 |
| Residual factor for significantly intense reflections |
0.0326 |
| Weighted residual factors for significantly intense reflections |
0.087 |
| Weighted residual factors for all reflections included in the refinement |
0.0893 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.041 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232752.html