Information card for entry 2232956
| Chemical name |
<i>N</i>,<i>N</i>'-Diallyl-2,2',5,5'-tetrachloro-<i>N</i>,<i>N</i>'- [1,3-phenylenebis(methylene)]dibenzenesulfonamide |
| Formula |
C26 H24 Cl4 N2 O4 S2 |
| Calculated formula |
C26 H24 Cl4 N2 O4 S2 |
| SMILES |
c1c(cccc1CN(CC=C)S(=O)(=O)c1c(ccc(c1)Cl)Cl)CN(CC=C)S(=O)(=O)c1c(ccc(c1)Cl)Cl |
| Title of publication |
<i>N</i>,<i>N</i>'-Diallyl-2,2',5,5'-tetrachloro-<i>N</i>,<i>N</i>'-[1,3-phenylenebis(methylene)]dibenzenesulfonamide |
| Authors of publication |
Sheikh, Tahir Ali; Ejaz; Khan, Islam Ullah; Harrison, William T. A. |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2011 |
| Journal volume |
67 |
| Journal issue |
12 |
| Pages of publication |
o3280 |
| a |
8.2744 ± 0.0002 Å |
| b |
11.3398 ± 0.0002 Å |
| c |
15.6481 ± 0.0004 Å |
| α |
87.777 ± 0.001° |
| β |
84.443 ± 0.001° |
| γ |
84.257 ± 0.001° |
| Cell volume |
1453.4 ± 0.06 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
6 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0666 |
| Residual factor for significantly intense reflections |
0.0443 |
| Weighted residual factors for significantly intense reflections |
0.1085 |
| Weighted residual factors for all reflections included in the refinement |
0.1215 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2232956.html