Information card for entry 2233073
| Chemical name |
20,23,26,29,32,35,38,41-octaoxa-5,9,13- triazapentacyclo[15.14.10.1^3,30^.1^7,11^.1^15,19^]tetratetraconta- 1,3(42),7,9,11(44),15(43),16,18,30-nonaene-6,12-dione acetone monosolvate |
| Formula |
C36 H45 N3 O11 |
| Calculated formula |
C36 H45 N3 O11 |
| SMILES |
O=C(C)C.O=C1NCc2cc3OCCOCCOCCOc4cc(cc(OCCOCCOCCOc(c3)c2)c4)CNC(=O)c2cc1cnc2 |
| Title of publication |
20,23,26,29,32,35,38,41-Octaoxa-5,9,13-triazapentacyclo[15.14.10.1^3,30^.1^7,11^.1^15,19^]tetratetraconta-1,3(42),7,9,11(44),15(43),16,18,30-nonaene-6,12-dione acetone monosolvate |
| Authors of publication |
Pan, Shaowu; Yang, Dengke; Yang, Yu; Jiang, Lasheng |
| Journal of publication |
Acta Crystallographica Section E |
| Year of publication |
2012 |
| Journal volume |
68 |
| Journal issue |
1 |
| Pages of publication |
o107 |
| a |
14.232 ± 0.003 Å |
| b |
14.232 ± 0.003 Å |
| c |
17.615 ± 0.004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
3567.9 ± 1.3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
78 |
| Hermann-Mauguin space group symbol |
P 43 |
| Hall space group symbol |
P 4cw |
| Residual factor for all reflections |
0.104 |
| Residual factor for significantly intense reflections |
0.0557 |
| Weighted residual factors for significantly intense reflections |
0.1409 |
| Weighted residual factors for all reflections included in the refinement |
0.1721 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.995 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2233073.html